CAS 1211741-22-8 appears in our catalog under these names: 2-{(3-(benzyloxy)phenyl)formamido}acetic acid, 95%, 2-{(3-(Benzyloxy)phenyl)formamido}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[(3-phenylmethoxybenzoyl)amino]acetic acid (CAS 1211741-22-8) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 2-[(3-phenylmethoxybenzoyl)amino]acetic acid. InChIKey: UNCHSERMWXXZNK-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 2-[(3-phenylmethoxybenzoyl)amino]acetic acid |
| InChIKey | UNCHSERMWXXZNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)