CAS 1211892-14-6 is the registry number for (Z)-N1-(4-Methoxybenzyl)-2-nitroethylene-1,1-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(Z)-1-N'-[(4-methoxyphenyl)methyl]-2-nitroethene-1,1-diamine (CAS 1211892-14-6) is a chemical compound with the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. IUPAC name: (Z)-1-N'-[(4-methoxyphenyl)methyl]-2-nitroethene-1,1-diamine. InChIKey: LEXSBVKEORUYFG-YFHOEESVSA-N.
| Molecular formula | C10H13N3O3 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | (Z)-1-N'-[(4-methoxyphenyl)methyl]-2-nitroethene-1,1-diamine |
| InChIKey | LEXSBVKEORUYFG-YFHOEESVSA-N |
| SMILES | COC1=CC=C(C=C1)CN/C(=C\[N+](=O)[O-])/N |
Computed by PubChem (NCBI)