Products 121199-17-5
CAS 121199-17-5 appears in our catalog under these names: 2-(6-bromo-3-oxoisoindolin-1-yl)acetic acid, 95%, 95%, 2-(6-Bromo-3-oxoisoindolin-1-yl)acetic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(6-bromo-3-oxo-1,2-dihydroisoindol-1-yl)acetic acid (CAS 121199-17-5) is a chemical compound with the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. IUPAC name: 2-(6-bromo-3-oxo-1,2-dihydroisoindol-1-yl)acetic acid. InChIKey: XVXSSJSVLDUNHM-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO3 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | 2-(6-bromo-3-oxo-1,2-dihydroisoindol-1-yl)acetic acid |
| InChIKey | XVXSSJSVLDUNHM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(NC2=O)CC(=O)O |
Computed by PubChem (NCBI)