CAS 121216-41-9 is the registry number for (S)-7-Amino-5,6,7,8-tetrahydro-naphthalen-2-ol hydrochloride ee. Offered by: Biosynth. Available pack sizes: 1000mg.
(7S)-7-amino-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride (CAS 121216-41-9) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (7S)-7-amino-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride. InChIKey: OOYNMFGNMGTBIL-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (7S)-7-amino-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride |
| InChIKey | OOYNMFGNMGTBIL-FVGYRXGTSA-N |
| SMILES | C1CC2=C(C[C@H]1N)C=C(C=C2)O.Cl |
Computed by PubChem (NCBI)