CAS 942077-83-0 is the registry number for 7-Amino-5,6,7,8-tetrahydro-naphthalen-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
7-amino-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride (CAS 942077-83-0) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 7-amino-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride. InChIKey: OOYNMFGNMGTBIL-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 7-amino-5,6,7,8-tetrahydronaphthalen-2-ol;hydrochloride |
| InChIKey | OOYNMFGNMGTBIL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1N)C=C(C=C2)O.Cl |
Computed by PubChem (NCBI)