Products 1212180-27-2
CAS 1212180-27-2 appears in our catalog under these names: (S)-2-Amino-3-(2-bromophenyl)-2-methylpropanoic acid, 95%, (S)-2-Amino-3-(2-bromophenyl)-2-methylpropanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2S)-2-amino-3-(2-bromophenyl)-2-methylpropanoic acid (CAS 1212180-27-2) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: (2S)-2-amino-3-(2-bromophenyl)-2-methylpropanoic acid. InChIKey: CEQZLKYRAINNIW-JTQLQIEISA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-bromophenyl)-2-methylpropanoic acid |
| InChIKey | CEQZLKYRAINNIW-JTQLQIEISA-N |
| SMILES | C[C@](CC1=CC=CC=C1Br)(C(=O)O)N |
Computed by PubChem (NCBI)