CAS 1212307-90-8 appears in our catalog under these names: (R)-α-Methyl-2-bromophenylalanine·H2O, D-Phenylalanine, 2-bromo-α-methyl-, 95%. Offered by: Creative Peptides, Chemat Brand. Available pack sizes: 1g, 5g, on request.
(2R)-2-amino-3-(2-bromophenyl)-2-methylpropanoic acid (CAS 1212307-90-8) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: (2R)-2-amino-3-(2-bromophenyl)-2-methylpropanoic acid. InChIKey: CEQZLKYRAINNIW-SNVBAGLBSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-bromophenyl)-2-methylpropanoic acid |
| InChIKey | CEQZLKYRAINNIW-SNVBAGLBSA-N |
| SMILES | C[C@@](CC1=CC=CC=C1Br)(C(=O)O)N |
Computed by PubChem (NCBI)