Products 2055118-98-2

CAS 2055118-98-2 is the registry number for 1-tert-Butyl 2-methyl 2-(2-methoxy-2-oxoethyl)azetidine-1,2-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl 2-(2-methoxy-2-oxoethyl)azetidine-1,2-dicarboxylate (CAS 2055118-98-2) is a chemical compound with the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 2-(2-methoxy-2-oxoethyl)azetidine-1,2-dicarboxylate. InChIKey: QZBKGCLOQLNBBY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21NO6
Molecular weight287.31 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 2-(2-methoxy-2-oxoethyl)azetidine-1,2-dicarboxylate
InChIKeyQZBKGCLOQLNBBY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC1(CC(=O)OC)C(=O)OC

Computed by PubChem (NCBI)