CAS 1212412-75-3 is the registry number for (2S)-2-(4-Oxo-2-sulfanyl-3,4-dihydroquinazolin-3-yl)-3-phenylpropanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-3-phenylpropanoic acid (CAS 1212412-75-3) is a chemical compound with the molecular formula C17H14N2O3S and a molecular weight of 326.4 g/mol. IUPAC name: (2S)-2-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-3-phenylpropanoic acid. InChIKey: VEPJYVUGUPXMQX-AWEZNQCLSA-N.
| Molecular formula | C17H14N2O3S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (2S)-2-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-3-phenylpropanoic acid |
| InChIKey | VEPJYVUGUPXMQX-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)N2C(=O)C3=CC=CC=C3NC2=S |
Computed by PubChem (NCBI)