Products 927982-98-7

CAS 927982-98-7 is the registry number for 2-((4-Phenoxyphenyl)amino)-4-methyl-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.

Structural formula: {0} (CAS {1})

4-methyl-2-(4-phenoxyanilino)-1,3-thiazole-5-carboxylic acid (CAS 927982-98-7) is a chemical compound with the molecular formula C17H14N2O3S and a molecular weight of 326.4 g/mol. IUPAC name: 4-methyl-2-(4-phenoxyanilino)-1,3-thiazole-5-carboxylic acid. InChIKey: WJXHSCMCRCLBNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O3S
Molecular weight326.4 g/mol
IUPAC name4-methyl-2-(4-phenoxyanilino)-1,3-thiazole-5-carboxylic acid
InChIKeyWJXHSCMCRCLBNQ-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)NC2=CC=C(C=C2)OC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)