CAS 17785-56-7 is the registry number for 2-(4-Oxo-2-sulfanyl-3,4-dihydroquinazolin-3-yl)-3-phenylpropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-3-phenylpropanoic acid (CAS 17785-56-7) is a chemical compound with the molecular formula C17H14N2O3S and a molecular weight of 326.4 g/mol. IUPAC name: 2-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-3-phenylpropanoic acid. InChIKey: VEPJYVUGUPXMQX-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 2-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-3-phenylpropanoic acid |
| InChIKey | VEPJYVUGUPXMQX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)N2C(=O)C3=CC=CC=C3NC2=S |
Computed by PubChem (NCBI)