CAS 927983-71-9 is the registry number for 2-(4-Phenoxyphenylamino-3,5-thiazolyl)acetic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
2-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]acetic acid (CAS 927983-71-9) is a chemical compound with the molecular formula C17H14N2O3S and a molecular weight of 326.4 g/mol. IUPAC name: 2-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]acetic acid. InChIKey: WBAYETGQAPPDOC-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 2-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | WBAYETGQAPPDOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NC3=NC(=CS3)CC(=O)O |
Computed by PubChem (NCBI)