Products 483350-66-9

CAS 483350-66-9 is the registry number for 2-((3-Benzyl-4-oxo-3,4-dihydroquinazolin-2-yl)sulfanyl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanylacetic acid (CAS 483350-66-9) is a chemical compound with the molecular formula C17H14N2O3S and a molecular weight of 326.4 g/mol. IUPAC name: 2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanylacetic acid. InChIKey: WGWDYFSTIFSBGL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O3S
Molecular weight326.4 g/mol
IUPAC name2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanylacetic acid
InChIKeyWGWDYFSTIFSBGL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN2C(=O)C3=CC=CC=C3N=C2SCC(=O)O

Computed by PubChem (NCBI)