Products 121251-67-0
CAS 121251-67-0 is the registry number for Spirambrene. Offered by: Biosynth. Available pack sizes: 25g, 50g, 100g.
(1'R,3'S,6'S)-2,2,3',7',7'-pentamethylspiro[1,3-dioxane-5,2'-bicyclo[4.1.0]heptane] (CAS 121251-67-0) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: (1'R,3'S,6'S)-2,2,3',7',7'-pentamethylspiro[1,3-dioxane-5,2'-bicyclo[4.1.0]heptane]. InChIKey: ORHSGDMSYGKJJY-SDDRHHMPSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | (1'R,3'S,6'S)-2,2,3',7',7'-pentamethylspiro[1,3-dioxane-5,2'-bicyclo[4.1.0]heptane] |
| InChIKey | ORHSGDMSYGKJJY-SDDRHHMPSA-N |
| SMILES | C[C@H]1CC[C@H]2[C@H](C2(C)C)C13COC(OC3)(C)C |
Computed by PubChem (NCBI)