Products 1212823-78-3
CAS 1212823-78-3 is the registry number for (1S,3S,5S,6S)-6-(Trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3S,5S,6S)-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS 1212823-78-3) is a chemical compound with the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. IUPAC name: (1S,3S,5S,6S)-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid. InChIKey: AUALRSWGZMNLIB-FCAWWPLPSA-N.
| Molecular formula | C7H8F3NO2 |
|---|---|
| Molecular weight | 195.14 g/mol |
| IUPAC name | (1S,3S,5S,6S)-6-(trifluoromethyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| InChIKey | AUALRSWGZMNLIB-FCAWWPLPSA-N |
| SMILES | C1[C@H]2[C@@H]([C@H]2N[C@@H]1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)