CAS 1518924-74-7 appears in our catalog under these names: 1-(2,2,2-Trifluoroethyl)piperidine-2,4-dione, 98%, 1-(2,2,2-Trifluoroethyl)piperidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
1-(2,2,2-trifluoroethyl)piperidine-2,4-dione (CAS 1518924-74-7) is a chemical compound with the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)piperidine-2,4-dione. InChIKey: PBBHLBQXEVOWIR-UHFFFAOYSA-N.
| Molecular formula | C7H8F3NO2 |
|---|---|
| Molecular weight | 195.14 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)piperidine-2,4-dione |
| InChIKey | PBBHLBQXEVOWIR-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CC1=O)CC(F)(F)F |
Computed by PubChem (NCBI)