CAS 65220-86-2 appears in our catalog under these names: 1-(trifluoroacetyl)piperidin-4-one, 97%, 1-(Trifluoroacetyl)-4-piperidinone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 500mg, 1000mg, 2000mg.
1-(2,2,2-trifluoroacetyl)piperidin-4-one (CAS 65220-86-2) is a chemical compound with the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. IUPAC name: 1-(2,2,2-trifluoroacetyl)piperidin-4-one. InChIKey: LUOSNGFOANFUES-UHFFFAOYSA-N.
| Molecular formula | C7H8F3NO2 |
|---|---|
| Molecular weight | 195.14 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroacetyl)piperidin-4-one |
| InChIKey | LUOSNGFOANFUES-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)