CAS 138610-12-5 is the registry number for 2,4-Pentanedione, 3-(1-amino-2,2,2-trifluoroethylidene)-, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-hydroxy-3-(2,2,2-trifluoroethanimidoyl)pent-3-en-2-one (CAS 138610-12-5) is a chemical compound with the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. IUPAC name: 4-hydroxy-3-(2,2,2-trifluoroethanimidoyl)pent-3-en-2-one. InChIKey: ZGZFEVLERGWXOL-UHFFFAOYSA-N.
| Molecular formula | C7H8F3NO2 |
|---|---|
| Molecular weight | 195.14 g/mol |
| IUPAC name | 4-hydroxy-3-(2,2,2-trifluoroethanimidoyl)pent-3-en-2-one |
| InChIKey | ZGZFEVLERGWXOL-UHFFFAOYSA-N |
| SMILES | CC(=C(C(=O)C)C(=N)C(F)(F)F)O |
Computed by PubChem (NCBI)