CAS 2357-39-3 appears in our catalog under these names: 4-(Propan-2-yl)-2-(trifluoromethyl)-2,5-dihydro-1,3-oxazol-5-one, 95%, 4-(Propan-2-yl)-2-(trifluoromethyl)-2,5-dihydro-1,3-oxazol-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-oxazol-5-one (CAS 2357-39-3) is a chemical compound with the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. IUPAC name: 4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-oxazol-5-one. InChIKey: TWLWBYBADKQLEE-UHFFFAOYSA-N.
| Molecular formula | C7H8F3NO2 |
|---|---|
| Molecular weight | 195.14 g/mol |
| IUPAC name | 4-propan-2-yl-2-(trifluoromethyl)-2H-1,3-oxazol-5-one |
| InChIKey | TWLWBYBADKQLEE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(OC1=O)C(F)(F)F |
Computed by PubChem (NCBI)