CAS 1212852-88-4 appears in our catalog under these names: (S)–5–Amino–5,6,7,8–tetrahydronaphthalene–2–carbonitrile, (S)-5-Amino-5,6,7,8-Tetrahydronaphthalene-2-Carbonitrile Hydrochloride, 98%, 98%, (S)-5-Amino-5,6,7,8-tetrahydronaphthalene-2-carbonitrile, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
(5S)-5-amino-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (CAS 1212852-88-4) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: (5S)-5-amino-5,6,7,8-tetrahydronaphthalene-2-carbonitrile. InChIKey: IGJCZZMPAPFDGB-NSHDSACASA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | (5S)-5-amino-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| InChIKey | IGJCZZMPAPFDGB-NSHDSACASA-N |
| SMILES | C1C[C@@H](C2=C(C1)C=C(C=C2)C#N)N |
Computed by PubChem (NCBI)