CAS 1212856-84-2 is the registry number for (S)-Ethyl 3-amino-3-(3,5-dichlorophenyl)propanoate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl (3S)-3-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride (CAS 1212856-84-2) is a chemical compound with the molecular formula C11H14Cl3NO2 and a molecular weight of 298.6 g/mol. IUPAC name: ethyl (3S)-3-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride. InChIKey: WTZLNIDVFBQYAB-PPHPATTJSA-N.
| Molecular formula | C11H14Cl3NO2 |
|---|---|
| Molecular weight | 298.6 g/mol |
| IUPAC name | ethyl (3S)-3-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride |
| InChIKey | WTZLNIDVFBQYAB-PPHPATTJSA-N |
| SMILES | CCOC(=O)C[C@@H](C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)