CAS 1955553-88-4 appears in our catalog under these names: 3-Amino-3-(3,5-dichlorophenyl)-2,2-dimethylpropanoic acid hydrochloride, 95%, 3-Amino-3-(3,5-dichlorophenyl)-2,2-dimethylpropanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-amino-3-(3,5-dichlorophenyl)-2,2-dimethylpropanoic acid;hydrochloride (CAS 1955553-88-4) is a chemical compound with the molecular formula C11H14Cl3NO2 and a molecular weight of 298.6 g/mol. IUPAC name: 3-amino-3-(3,5-dichlorophenyl)-2,2-dimethylpropanoic acid;hydrochloride. InChIKey: MORVNQJSBKYQQK-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO2 |
|---|---|
| Molecular weight | 298.6 g/mol |
| IUPAC name | 3-amino-3-(3,5-dichlorophenyl)-2,2-dimethylpropanoic acid;hydrochloride |
| InChIKey | MORVNQJSBKYQQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=CC(=CC(=C1)Cl)Cl)N)C(=O)O.Cl |
Computed by PubChem (NCBI)