CAS 502842-02-6 appears in our catalog under these names: Ethyl 3-amino-3-(2,4-dichlorophenyl)propanoate hydrochloride, 98%, Ethyl 3-amino-3-(2,4-dichlorophenyl)propanoate, hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g, 0,5g.
Ethyl 3-amino-3-(2,4-dichlorophenyl)propanoate;hydrochloride (CAS 502842-02-6) is a chemical compound with the molecular formula C11H14Cl3NO2 and a molecular weight of 298.6 g/mol. IUPAC name: ethyl 3-amino-3-(2,4-dichlorophenyl)propanoate;hydrochloride. InChIKey: FZDCBTFZCCIEDO-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO2 |
|---|---|
| Molecular weight | 298.6 g/mol |
| IUPAC name | ethyl 3-amino-3-(2,4-dichlorophenyl)propanoate;hydrochloride |
| InChIKey | FZDCBTFZCCIEDO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=C(C=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)