CAS 1587207-65-5 is the registry number for 3-((3,4-Dichlorobenzyl)(methyl)amino)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3,4-dichlorophenyl)methyl-methylamino]propanoic acid;hydrochloride (CAS 1587207-65-5) is a chemical compound with the molecular formula C11H14Cl3NO2 and a molecular weight of 298.6 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)methyl-methylamino]propanoic acid;hydrochloride. InChIKey: MPVQCVHTPMSKHM-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO2 |
|---|---|
| Molecular weight | 298.6 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)methyl-methylamino]propanoic acid;hydrochloride |
| InChIKey | MPVQCVHTPMSKHM-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)O)CC1=CC(=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)