CAS 856571-00-1 appears in our catalog under these names: Ethyl 2-amino-3-(3,5-dichlorophenyl)propanoate hydrochloride, 95%, Ethyl 2-amino-3-(3,5-dichlorophenyl)propanoate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 2-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride (CAS 856571-00-1) is a chemical compound with the molecular formula C11H14Cl3NO2 and a molecular weight of 298.6 g/mol. IUPAC name: ethyl 2-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride. InChIKey: RNCPPLJNPRTWBU-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl3NO2 |
|---|---|
| Molecular weight | 298.6 g/mol |
| IUPAC name | ethyl 2-amino-3-(3,5-dichlorophenyl)propanoate;hydrochloride |
| InChIKey | RNCPPLJNPRTWBU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)