Products 1212922-33-2
CAS 1212922-33-2 is the registry number for (R)-2,2,2-Trifluoro-1-(3-(trifluoromethoxy)phenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2,2-trifluoro-1-[3-(trifluoromethoxy)phenyl]ethanamine (CAS 1212922-33-2) is a chemical compound with the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-[3-(trifluoromethoxy)phenyl]ethanamine. InChIKey: MAMFWZFFEYGAAN-SSDOTTSWSA-N.
| Molecular formula | C9H7F6NO |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-[3-(trifluoromethoxy)phenyl]ethanamine |
| InChIKey | MAMFWZFFEYGAAN-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)