CAS 1213074-03-3 appears in our catalog under these names: (R)-1-(4-Chlorophenyl)-2,2,2-trifluoroethanamine hydrochloride, 98%, 98%, (R)-2,2,2-Trifluoro-1-(4-chloro-phenyl)-ethylamine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(1R)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 1213074-03-3) is a chemical compound with the molecular formula C8H8Cl2F3N and a molecular weight of 246.05 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: RZJUXIWKZNYCAS-OGFXRTJISA-N.
| Molecular formula | C8H8Cl2F3N |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | RZJUXIWKZNYCAS-OGFXRTJISA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)N)Cl.Cl |
Computed by PubChem (NCBI)