CAS 39959-48-3 is the registry number for (2-Chloro-3-(trifluoromethyl)phenyl)methanamine hydrochloride, 98+%. Offered by: AmBeed. Available pack sizes: 250mg.
[2-chloro-3-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 39959-48-3) is a chemical compound with the molecular formula C8H8Cl2F3N and a molecular weight of 246.05 g/mol. IUPAC name: [2-chloro-3-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: WOUQDMMHZDTEEG-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2F3N |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | [2-chloro-3-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | WOUQDMMHZDTEEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)Cl)CN.Cl |
Computed by PubChem (NCBI)