CAS 1391489-27-2 appears in our catalog under these names: (S)–1–(2–Chlorophenyl)–2,2,2–trifluoroethanamine hydrochloride, (1S)-1-(2-Chlorophenyl)-2,2,2-trifluoro-ethanamine hydrochloride, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(2-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 1391489-27-2) is a chemical compound with the molecular formula C8H8Cl2F3N and a molecular weight of 246.05 g/mol. IUPAC name: (1S)-1-(2-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: AKWSNJCOFZXRPH-FJXQXJEOSA-N.
| Molecular formula | C8H8Cl2F3N |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | (1S)-1-(2-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | AKWSNJCOFZXRPH-FJXQXJEOSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](C(F)(F)F)N)Cl.Cl |
Computed by PubChem (NCBI)