CAS 1228879-10-4 appears in our catalog under these names: 1-(3-Chlorophenyl)-2,2,2-trifluoroethan-1-amine hydrochloride, 95%, 1–(3–Chlorophenyl)–2,2,2–trifluoroethanamine hydrochloride, 1-(3-Chlorophenyl)-2,2,2-trifluoroethan-1-amine hydrochloride, 97%, 97%, 1-(3-Chlorophenyl)-2,2,2-trifluoroethanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-(3-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 1228879-10-4) is a chemical compound with the molecular formula C8H8Cl2F3N and a molecular weight of 246.05 g/mol. IUPAC name: 1-(3-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: LSFNVRBSWOHDHQ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2F3N |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | LSFNVRBSWOHDHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)