CAS 336105-42-1 appears in our catalog under these names: (S)-1-(4-Chlorophenyl)-2,2,2-trifluoroethanamine hydrochloride, 96%, (S)-1-(4-Chlorophenyl)-2,2,2-trifluoroethanamine hydrochloride, 96%, 96%, (S)-2,2,2-Trifluoro-1-(4-chloro-phenyl)-ethylamine hydrochloride, 96%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg, 500mg.
(1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 336105-42-1) is a chemical compound with the molecular formula C8H8Cl2F3N and a molecular weight of 246.05 g/mol. IUPAC name: (1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: RZJUXIWKZNYCAS-FJXQXJEOSA-N.
| Molecular formula | C8H8Cl2F3N |
|---|---|
| Molecular weight | 246.05 g/mol |
| IUPAC name | (1S)-1-(4-chlorophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | RZJUXIWKZNYCAS-FJXQXJEOSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](C(F)(F)F)N)Cl.Cl |
Computed by PubChem (NCBI)