Products 1213208-62-8

CAS 1213208-62-8 is the registry number for (R)-2-Fluoro-6-(pyrrolidin-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-fluoro-6-[(2R)-pyrrolidin-2-yl]benzoic acid (CAS 1213208-62-8) is a chemical compound with the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. IUPAC name: 2-fluoro-6-[(2R)-pyrrolidin-2-yl]benzoic acid. InChIKey: SVLDYPLFHJDVBW-SECBINFHSA-N.

Identity
Molecular formulaC11H12FNO2
Molecular weight209.22 g/mol
IUPAC name2-fluoro-6-[(2R)-pyrrolidin-2-yl]benzoic acid
InChIKeySVLDYPLFHJDVBW-SECBINFHSA-N
SMILESC1C[C@@H](NC1)C2=C(C(=CC=C2)F)C(=O)O

Computed by PubChem (NCBI)