CAS 1213330-10-9 is the registry number for (R)-2-(2,3-Dichlorophenyl)piperidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(2,3-dichlorophenyl)piperidine (CAS 1213330-10-9) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: (2R)-2-(2,3-dichlorophenyl)piperidine. InChIKey: SVTIFKIPTUYJLE-SNVBAGLBSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | (2R)-2-(2,3-dichlorophenyl)piperidine |
| InChIKey | SVTIFKIPTUYJLE-SNVBAGLBSA-N |
| SMILES | C1CCN[C@H](C1)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)