CAS 143017-59-8 is the registry number for 4-(3-Chlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(3-chlorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride (CAS 143017-59-8) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 4-(3-chlorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride. InChIKey: WHJHLHRSTDZYND-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-1,2,3,6-tetrahydropyridine;hydrochloride |
| InChIKey | WHJHLHRSTDZYND-UHFFFAOYSA-N |
| SMILES | C1CNCC=C1C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)