CAS 1315372-50-9 is the registry number for 1-(2-(2,5-Dichlorophenyl)cyclopropyl)-N-methylmethanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(2,5-dichlorophenyl)cyclopropyl]-N-methylmethanamine (CAS 1315372-50-9) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 1-[2-(2,5-dichlorophenyl)cyclopropyl]-N-methylmethanamine. InChIKey: AVUHGMULPMRLRZ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 1-[2-(2,5-dichlorophenyl)cyclopropyl]-N-methylmethanamine |
| InChIKey | AVUHGMULPMRLRZ-UHFFFAOYSA-N |
| SMILES | CNCC1CC1C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)