CAS 1864057-98-6 is the registry number for 6,7-Dichloro-4,4-dimethyl-2,3-dihydro-1H-quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6,7-dichloro-4,4-dimethyl-2,3-dihydro-1H-quinoline (CAS 1864057-98-6) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 6,7-dichloro-4,4-dimethyl-2,3-dihydro-1H-quinoline. InChIKey: LLZRJCKMXIWQEC-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 6,7-dichloro-4,4-dimethyl-2,3-dihydro-1H-quinoline |
| InChIKey | LLZRJCKMXIWQEC-UHFFFAOYSA-N |
| SMILES | CC1(CCNC2=CC(=C(C=C21)Cl)Cl)C |
Computed by PubChem (NCBI)