Products 1213415-33-8
CAS 1213415-33-8 is the registry number for Boc-L-Phe(3-OPh)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenoxyphenyl)propanoic acid (CAS 1213415-33-8) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenoxyphenyl)propanoic acid. InChIKey: FNVJDYQQJDPXDX-KRWDZBQOSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-phenoxyphenyl)propanoic acid |
| InChIKey | FNVJDYQQJDPXDX-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)OC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)