Products 1213440-92-6
CAS 1213440-92-6 is the registry number for (S)-benzofuran-2-yl(cyclopropyl)methanamine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(S)-1-benzofuran-2-yl(cyclopropyl)methanamine (CAS 1213440-92-6) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: (S)-1-benzofuran-2-yl(cyclopropyl)methanamine. InChIKey: TYOXHAPCASBZJK-LBPRGKRZSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (S)-1-benzofuran-2-yl(cyclopropyl)methanamine |
| InChIKey | TYOXHAPCASBZJK-LBPRGKRZSA-N |
| SMILES | C1CC1[C@@H](C2=CC3=CC=CC=C3O2)N |
Computed by PubChem (NCBI)