Products 1213565-29-7
CAS 1213565-29-7 is the registry number for (S)-1-(3-Chloro-4-(trifluoromethoxy)phenyl)-2-methylpropan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-methylpropan-1-amine (CAS 1213565-29-7) is a chemical compound with the molecular formula C11H13ClF3NO and a molecular weight of 267.67 g/mol. IUPAC name: (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-methylpropan-1-amine. InChIKey: PWEYQGIMHPNGSB-JTQLQIEISA-N.
| Molecular formula | C11H13ClF3NO |
|---|---|
| Molecular weight | 267.67 g/mol |
| IUPAC name | (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2-methylpropan-1-amine |
| InChIKey | PWEYQGIMHPNGSB-JTQLQIEISA-N |
| SMILES | CC(C)[C@@H](C1=CC(=C(C=C1)OC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)