Products 1213607-71-6
CAS 1213607-71-6 is the registry number for (S)-2-(2,6-Dichlorophenyl)-2-(methylamino)ethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(2,6-dichlorophenyl)-2-(methylamino)ethanol (CAS 1213607-71-6) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (2S)-2-(2,6-dichlorophenyl)-2-(methylamino)ethanol. InChIKey: YPXNWLRSDRZHBJ-MRVPVSSYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (2S)-2-(2,6-dichlorophenyl)-2-(methylamino)ethanol |
| InChIKey | YPXNWLRSDRZHBJ-MRVPVSSYSA-N |
| SMILES | CN[C@H](CO)C1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)