Products 1257526-90-1
CAS 1257526-90-1 appears in our catalog under these names: (R)-6-Chlorochroman-4-amine hydrochloride, 95%, (R)–6–chlorochroman–4–amine hcl, (R)-6-chlorochroman-4-amine hcl, 98%, 98%, (R)-6-chlorochroman-4-amine hcl, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(4R)-6-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1257526-90-1) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (4R)-6-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: ARFUFGWFRJZAHS-DDWIOCJRSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (4R)-6-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | ARFUFGWFRJZAHS-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)