CAS 1188375-01-0 appears in our catalog under these names: 3-(2-Chlorophenoxy)azetidine hydrochloride, 95%, 3-(2-Chlorophenoxy)azetidine hydrochloride, 97%, 3-(2-Chlorophenoxy)azetidine hydrochloride, 3-(2-Chlorophenoxy)azetidine hydrochloride, 97%, 97%, 3-(2-chlorophenoxy)azetidine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 0,5g, 500mg.
3-(2-chlorophenoxy)azetidine;hydrochloride (CAS 1188375-01-0) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 3-(2-chlorophenoxy)azetidine;hydrochloride. InChIKey: OIJASKMSOZDCSI-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 3-(2-chlorophenoxy)azetidine;hydrochloride |
| InChIKey | OIJASKMSOZDCSI-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC=CC=C2Cl.Cl |
Computed by PubChem (NCBI)