Products 2241594-30-7
CAS 2241594-30-7 appears in our catalog under these names: (R)–7–CHLOROCHROMAN–4–AMINE HCL, (R)-7-Chlorochroman-4-amine hydrochloride, 95%, (R)-7-CHLOROCHROMAN-4-AMINE HCL, 98%, (R)-7-CHLOROCHROMAN-4-AMINE HCL, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4R)-7-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 2241594-30-7) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (4R)-7-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: MUKIHNNHMAAWPC-DDWIOCJRSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (4R)-7-chloro-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | MUKIHNNHMAAWPC-DDWIOCJRSA-N |
| SMILES | C1COC2=C([C@@H]1N)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)