Products 1881330-34-2
CAS 1881330-34-2 is the registry number for 3,5-dichloro-2-(2-methylpropoxy)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,5-dichloro-2-(2-methylpropoxy)pyridine (CAS 1881330-34-2) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 3,5-dichloro-2-(2-methylpropoxy)pyridine. InChIKey: ILZCVHKPHLJTTB-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 3,5-dichloro-2-(2-methylpropoxy)pyridine |
| InChIKey | ILZCVHKPHLJTTB-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)