CAS 1379957-89-7 is the registry number for 3–Amino–3–(3–bromophenyl)propan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
3-amino-3-(3-bromophenyl)propan-1-ol;hydrochloride (CAS 1379957-89-7) is a chemical compound with the molecular formula C9H13BrClNO and a molecular weight of 266.56 g/mol. IUPAC name: 3-amino-3-(3-bromophenyl)propan-1-ol;hydrochloride. InChIKey: VFRCPFDLHRPOIA-UHFFFAOYSA-N.
| Molecular formula | C9H13BrClNO |
|---|---|
| Molecular weight | 266.56 g/mol |
| IUPAC name | 3-amino-3-(3-bromophenyl)propan-1-ol;hydrochloride |
| InChIKey | VFRCPFDLHRPOIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(CCO)N.Cl |
Computed by PubChem (NCBI)