CAS 121405-24-1 is the registry number for CGP062464. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 121405-24-1) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: AFVGAHBUCVDPPI-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 5,7-diphenylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | AFVGAHBUCVDPPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(C3=NC=NC(=C23)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)