CAS 2862825-43-0 is the registry number for 5-Fluoro-3-methyl-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-3-methyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;hydrochloride (CAS 2862825-43-0) is a chemical compound with the molecular formula C8H8ClFN2O and a molecular weight of 202.61 g/mol. IUPAC name: 5-fluoro-3-methyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;hydrochloride. InChIKey: UGAKTDJTHRJBDX-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 5-fluoro-3-methyl-1,3-dihydropyrrolo[2,3-b]pyridin-2-one;hydrochloride |
| InChIKey | UGAKTDJTHRJBDX-UHFFFAOYSA-N |
| SMILES | CC1C2=C(NC1=O)N=CC(=C2)F.Cl |
Computed by PubChem (NCBI)