CAS 121431-17-2 is the registry number for N-(4-Chlorophenyl)-2-hydroxy-N-isopropylacetamide, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
N-(4-chlorophenyl)-2-hydroxy-N-propan-2-ylacetamide (CAS 121431-17-2) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: N-(4-chlorophenyl)-2-hydroxy-N-propan-2-ylacetamide. InChIKey: OLCFDRRWUXUESH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2-hydroxy-N-propan-2-ylacetamide |
| InChIKey | OLCFDRRWUXUESH-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=C(C=C1)Cl)C(=O)CO |
Computed by PubChem (NCBI)