Products 1214331-55-1

CAS 1214331-55-1 is the registry number for 4-Fluoro-3-methoxymandelic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-fluoro-3-methoxyphenyl)-2-hydroxyacetic acid (CAS 1214331-55-1) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 2-(4-fluoro-3-methoxyphenyl)-2-hydroxyacetic acid. InChIKey: RQLBYQAWBBRAIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO4
Molecular weight200.16 g/mol
IUPAC name2-(4-fluoro-3-methoxyphenyl)-2-hydroxyacetic acid
InChIKeyRQLBYQAWBBRAIQ-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(C(=O)O)O)F

Computed by PubChem (NCBI)