Products 368422-22-4

CAS 368422-22-4 is the registry number for 2-Fluoro-6-(methoxymethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-fluoro-6-(methoxymethoxy)benzoic acid (CAS 368422-22-4) is a chemical compound with the molecular formula C9H9FO4 and a molecular weight of 200.16 g/mol. IUPAC name: 2-fluoro-6-(methoxymethoxy)benzoic acid. InChIKey: BSQHNMMSMWHKBI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO4
Molecular weight200.16 g/mol
IUPAC name2-fluoro-6-(methoxymethoxy)benzoic acid
InChIKeyBSQHNMMSMWHKBI-UHFFFAOYSA-N
SMILESCOCOC1=C(C(=CC=C1)F)C(=O)O

Computed by PubChem (NCBI)